|
|
| | endo-8-isopropyl-8-azabicyclo[3.2.1]octan-3-ol Basic information |
| Product Name: | endo-8-isopropyl-8-azabicyclo[3.2.1]octan-3-ol | | Synonyms: | endo-8-isopropyl-8-azabicyclo[3.2.1]octan-3-ol;8-(1-METHYLETHYL)-8-AZABISCYCLO(3.2.1)OCTAN-3-OL;N-Isopropylnortropin;8-Isopropylnortropine;(1β,5β)-8-(1-Methylethyl)-8-azabicyclo[3.2.1]octan-3α-ol;1Alphah,5alphah-nortropan-3alpha-ol, 8-isopropyl-;Einecs 222-314-9;8-Azabicyclo[3.2.1]octan-3-ol,8-(1-Methylethyl)-, (3-endo)- | | CAS: | 3423-25-4 | | MF: | C10H19NO | | MW: | 169.27 | | EINECS: | 222-314-9 | | Product Categories: | | | Mol File: | 3423-25-4.mol | ![endo-8-isopropyl-8-azabicyclo[3.2.1]octan-3-ol Structure](CAS/GIF/3423-25-4.gif) |
| | endo-8-isopropyl-8-azabicyclo[3.2.1]octan-3-ol Chemical Properties |
| Boiling point | 266.9±15.0℃ (760 Torr) | | density | 1.037±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 89.7±14.5℃ | | storage temp. | Room Temperature | | solubility | Dichloromethane; Ethyl Acetate; | | pka | 14.84±0.20(Predicted) | | form | Solid | | color | White | | InChI | InChI=1/C10H19NO/c1-7(2)11-8-3-4-9(11)6-10(12)5-8/h7-10,12H,3-6H2,1-2H3/t8-,9+,10+ | | InChIKey | YYDQYSQZIUSKFN-MYJAWHEDNA-N | | SMILES | C(N1[C@H]2CC[C@@H]1C[C@H](O)C2)(C)C |&1:2,5,7,r| |
| | endo-8-isopropyl-8-azabicyclo[3.2.1]octan-3-ol Usage And Synthesis |
| Chemical Properties | White needle-shaped crystals, melting point 112-114°C. | | Uses | (1R,5S)-8-Isopropyl-8-azabicyclo[3.2.1]octan-3-ol is an intermediate for the synthesis of (S)-(1R,3r,5S)-8-Isopropyl-8-azabicyclo[3.2.1]octan-3-yl 3-Hydroxy-2-phenylpropanoate (I824270), which is a compound that can be synthesized from Atropine (A794630), a nerve agent that occurs naturally in plants of the nightshade family. |
| | endo-8-isopropyl-8-azabicyclo[3.2.1]octan-3-ol Preparation Products And Raw materials |
|