4-methyl-1-phenylpentan-1-one manufacturers
|
| | 4-methyl-1-phenylpentan-1-one Basic information |
| Product Name: | 4-methyl-1-phenylpentan-1-one | | Synonyms: | 4-methyl-1-phenylpentan-1-one;1-Phenyl-4-methyl-1-pentanone;1-Phenyl-4-methylpentane-1-one;4-Methyl-1-phenyl-1-pentanone;Isopentyl(phenyl) ketone;1-Pentanone, 4-methyl-1-phenyl- | | CAS: | 2050-07-9 | | MF: | C12H16O | | MW: | 176.25 | | EINECS: | 218-079-7 | | Product Categories: | | | Mol File: | 2050-07-9.mol |  |
| | 4-methyl-1-phenylpentan-1-one Chemical Properties |
| Melting point | -1°C | | Boiling point | 255.5°C (estimate) | | density | 0.9623 | | refractive index | 1.5330 (estimate) | | solubility | soluble in Chloroform | | form | Oil | | color | Colorless | | InChI | InChI=1S/C12H16O/c1-10(2)8-9-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 | | InChIKey | WRJZDDJYWWJLIS-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)CCC(C)C |
| | 4-methyl-1-phenylpentan-1-one Usage And Synthesis |
| Uses | 4-Methyl-valerophenone is an intermediate used in the synthesis of a-Pyrrolidinoisohexanophenone (Hydrochloride) (P841230), which is a phenone derivative used for research purposes. |
| | 4-methyl-1-phenylpentan-1-one Preparation Products And Raw materials |
|