|
|
| | Cysteamine bitartrate Basic information |
| Product Name: | Cysteamine bitartrate | | Synonyms: | (mercaptoethyl)ammonium hydrogen tartrate;Cysteamine bitartrate;Cystagon;CYSTEAMINE BITRATRATE;2-Aminoethanethiol (2R,3R)-2,3-dihydroxysuccinate;Mercaptamine bitartrate | | CAS: | 27761-19-9 | | MF: | C6H13NO6S | | MW: | 227.23 | | EINECS: | 248-641-7 | | Product Categories: | | | Mol File: | 27761-19-9.mol |  |
| | Cysteamine bitartrate Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMSO: 45 mg/mL (198.03 mM);Ethanol: Insoluble | | Water Solubility | Water: 45 mg/mL (198.03 mM) | | InChI | InChI=1/C4H6O6.C2H7NS/c5-1(3(7)8)2(6)4(9)10;3-1-2-4/h1-2,5-6H,(H,7,8)(H,9,10);4H,1-3H2/t1-,2-;/s3 | | InChIKey | NSKJTUFFDRENDM-RZHFEHKBNA-N | | SMILES | C(N)CS.[C@H](O)(C(=O)O)[C@@H](O)C(=O)O |&1:4,9,r| |
| | Cysteamine bitartrate Usage And Synthesis |
| Description | Cysteamine bitartrate is an amino thiol and a byproduct of the cysteine degradation pathway that is an FDA-approved therapy for the treatment of nephropathic cystinosis to decrease the accumulation of lysosomal cystine (the disulfide-linked form of cysteine) by engaging in disulfide exchange. In addition, cysteamine bitartrate has been postulated to have broader antioxidant properties potentially related to a distinct role in increasing cysteine availability to support the biosynthesis of the potent antioxidant molecule glutathione[1].
| | References | [1] Sujay Guha. “Pre-clinical evaluation of cysteamine bitartrate as a therapeutic agent for mitochondrial respiratory chain disease.” Human molecular genetics (2019): 1837–1852. | | Uses | Cysteamine bitartrate (CAS# 27761-19-9) treatment of cystinosis and other metabolic and neurodegenerative diseases. |
| | Cysteamine bitartrate Preparation Products And Raw materials |
|