|
| 2-Amino-5-chloro-2'-fluorobenzophenone Basic information |
| 2-Amino-5-chloro-2'-fluorobenzophenone Chemical Properties |
Melting point | 95-98 °C(lit.) | Boiling point | 207C | density | 1.3134 (estimate) | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | solubility | Chloroform (Slightly), Methanol (Slightly) | form | Solid | pka | -1.05±0.10(Predicted) | color | Yellow | InChI | InChI=1S/C13H9ClFNO/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7H,16H2 | InChIKey | GTGMXPIQRQSORU-UHFFFAOYSA-N | SMILES | C(C1=CC(Cl)=CC=C1N)(C1=CC=CC=C1F)=O | CAS DataBase Reference | 784-38-3(CAS DataBase Reference) | NIST Chemistry Reference | Methanone, (2-amino-5-chlorophenyl)(2-fluorophenyl)-(784-38-3) |
| 2-Amino-5-chloro-2'-fluorobenzophenone Usage And Synthesis |
Chemical Properties | YELLOW FINE POWDER | Uses | A starting material for the synthesis of diazepam and other benzodiazepines | Uses | Flurazepam synthon | Uses | Employed in the syntheses of benzotriazepines1 and diazepam-related benzodiazepines.2 |
| 2-Amino-5-chloro-2'-fluorobenzophenone Preparation Products And Raw materials |
|