|
|
| | Bis(di-tert-butyl)-4-dimethylaminophenylphosphine Basic information | | Use Reaction |
| Product Name: | Bis(di-tert-butyl)-4-dimethylaminophenylphosphine | | Synonyms: | Bis(di-tert-butyl)-4-dimethylaminophenylphosphine;[(4-Dimethylaminophenyl)]di(tert-butyl)phosphine;[4-(Dimethylamino)phenyl]bis(tert-butyl)phosphine;N,N-Dimethyl 4-(di(tert-butyl)phosphino)aniline;[4-(N,N-DiMethylaMino)phenyl]di-t-butylphosphine, Min. 95% aMphos;(4-(N,N-diMethylaMino)phenyl)di-t-butylphosphine, 98%;Aphos 95%;[4-(N,N-Dimethylamino)phenyl]di-t-butylphosphine, min. 95% | | CAS: | 932710-63-9 | | MF: | C16H28NP | | MW: | 265.37 | | EINECS: | | | Product Categories: | Achiral Phosphine;Aryl Phosphine | | Mol File: | 932710-63-9.mol |  |
| | Bis(di-tert-butyl)-4-dimethylaminophenylphosphine Chemical Properties |
| Melting point | 57-61°C | | Boiling point | 349.1±25.0 °C(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Acetone | | form | crystal | | pka | 4.73±0.24(Predicted) | | color | white to light-brown | | InChI | InChI=1S/C16H28NP/c1-15(2,3)18(16(4,5)6)14-11-9-13(10-12-14)17(7)8/h9-12H,1-8H3 | | InChIKey | IQTHEAQKKVAXGV-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=CC=C(P(C(C)(C)C)C(C)(C)C)C=C1 | | CAS DataBase Reference | 932710-63-9 |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2931499090 | | Storage Class | 8B - Non-combustible, corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Bis(di-tert-butyl)-4-dimethylaminophenylphosphine Usage And Synthesis |
| Use | Bis(di-tert-butyl)-4-dimethylaminophenylphosphine is an organophosphine compound and can be used as an organophosphine ligand. | | Reaction |
- Ligand used in a highly-active palladium precatalyst for the efficient amination of aryl chloride.
- Ligand used in the palladium-catalyzed annulations under microwave enhanced conditions.
| | Uses | Amphos can be used as an electrophotographic photoreceptor, process cartridge, and image forming electrode. | | Uses | Ligand used to prepare a palladium dichloride catalyst (678740) on treatment with PdCl2(COD). The catalyst effectively cross-couples aryl boronic acids with heteroaryl chlorides. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst
reagent type: ligand
reaction type: Cross Couplings | | References | [1] Patent: CN105237568, 2017, B. Location in patent: Paragraph 0061-0063 |
| | Bis(di-tert-butyl)-4-dimethylaminophenylphosphine Preparation Products And Raw materials |
|