|
|
| | Ethylmethyldichlorosilane Basic information |
| Product Name: | Ethylmethyldichlorosilane | | Synonyms: | ETHYLMETHYLDICHLOROSILANE;DICHLOROETHYLMETHYLSILANE;dichloroethylmethyl-silan;Ethyldichloromethylsilane~Ethylmethyldichlorosilane;Silane, dichloroethylmethyl-;ethyldichloromethylsilane;Methylethyldichlorosilane;ETHYLMETHYLDICHLOROSILANE 97% MIN | | CAS: | 4525-44-4 | | MF: | C3H8Cl2Si | | MW: | 143.09 | | EINECS: | 224-860-3 | | Product Categories: | | | Mol File: | 4525-44-4.mol |  |
| | Ethylmethyldichlorosilane Chemical Properties |
| Melting point | 8°C | | Boiling point | 100 °C(lit.) | | density | 1.063 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.419(lit.) | | Fp | 54 °F | | Specific Gravity | 1.063 | | Sensitive | Moisture Sensitive | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | BRN | 1361374 | | InChI | InChI=1S/C3H8Cl2Si/c1-6-2-3(4)5/h3H,2,6H2,1H3 | | InChIKey | BYKDIAHBFKIHHS-UHFFFAOYSA-N | | SMILES | [SiH2](CC(Cl)Cl)C | | CAS DataBase Reference | 4525-44-4(CAS DataBase Reference) | | EPA Substance Registry System | Silane, dichloroethylmethyl- (4525-44-4) |
| Hazard Codes | F,C | | Risk Statements | 11-34 | | Safety Statements | 16-26-28-36/37/39-45 | | RIDADR | UN 2985 3/PG 2 | | WGK Germany | 1 | | F | 10-21 | | TSCA | Yes | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29319090 |
| | Ethylmethyldichlorosilane Usage And Synthesis |
| Chemical Properties | colorless liquid | | Uses | Ethylmethyldichlorosilane is the raw material for producing silicone rubber and silicone resin. Silicone resins has many advantages over natural rubber. |
| | Ethylmethyldichlorosilane Preparation Products And Raw materials |
|