|
|
| | 7-Chlorothieno[3,2-b]pyridine Basic information |
| | 7-Chlorothieno[3,2-b]pyridine Chemical Properties |
| Melting point | 34.0-35.5 °C | | Boiling point | 257.5±20.0 °C(Predicted) | | density | 1.435±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder to lump | | pka | 2.87±0.30(Predicted) | | color | White to Yellow to Orange | | InChI | InChI=1S/C7H4ClNS/c8-5-1-3-9-6-2-4-10-7(5)6/h1-4H | | InChIKey | GYQUXKQLCNFKQT-UHFFFAOYSA-N | | SMILES | C12C=CSC1=C(Cl)C=CN=2 |
| | 7-Chlorothieno[3,2-b]pyridine Usage And Synthesis |
| Uses | 7-Chlorothieno[3,2-b]pyridine is a pyridine derivative and a pharmaceutical intermediate compound. It can be used in the preparation of piperidines and deuterated thiophene pyridine compounds, and can also be used in the synthesis of compounds with anticancer activity. | | Chemical Properties | 7-Chlorothieno[3,2-b]pyridine is a white to yellow to orange powder to lumpy intermediate composition. It has a melting point of 35 °C and a flash point of 110 °C. It is stored at 0-10 °C. It is irritating to eyes and skin. |
| | 7-Chlorothieno[3,2-b]pyridine Preparation Products And Raw materials |
|