|
|
| | 2-Ethylhexyl 4-dimethylaminobenzoate Basic information |
| | 2-Ethylhexyl 4-dimethylaminobenzoate Chemical Properties |
| Melting point | 242.5-243.5 °C | | Boiling point | 325 °C (lit.) | | density | 0.995 g/mL at 25 °C (lit.) | | vapor pressure | 0.001Pa at 25℃ | | refractive index | n20/D 1.542(lit.) | | Fp | >230 °F | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 2.39±0.12(Predicted) | | form | liquid | | Specific Gravity | 0.995 | | color | Off-White to Orange | | Water Solubility | 100μg/L at 20℃ | | Merck | 14,3232 | | Cosmetics Ingredients Functions | UV ABSORBER
UV FILTER
LIGHT STABILIZER | | InChI | 1S/C17H27NO2/c1-5-7-8-14(6-2)13-20-17(19)15-9-11-16(12-10-15)18(3)4/h9-12,14H,5-8,13H2,1-4H3 | | InChIKey | WYWZRNAHINYAEF-UHFFFAOYSA-N | | SMILES | CCCCC(CC)COC(=O)c1ccc(cc1)N(C)C | | LogP | 6.2 | | CAS DataBase Reference | 21245-02-3(CAS DataBase Reference) | | NIST Chemistry Reference | Padimate o(21245-02-3) | | EPA Substance Registry System | 2-Ethylhexyl p-dimethylaminobenzoate (21245-02-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-27-36 | | WGK Germany | 2 | | TSCA | TSCA listed | | HS Code | 29224999 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B | | Hazardous Substances Data | 21245-02-3(Hazardous Substances Data) |
| | 2-Ethylhexyl 4-dimethylaminobenzoate Usage And Synthesis |
| Chemical Properties | Colorless to yellow liquid | | Uses | 2-ethylhexyl-4-dimethyl-amino-benzoate is used as an UV-B-absorbing agent in sunscreens and cosmetic creams, lotions, lipsticks, sun oils, moisturizers, nail polish, etc. | | Uses | Ultraviolet screen Arlatone. | | Uses | padimate O is the drug name for ethylhexyl dimethyl PABA, a sunscreen chemical formerly known as octyl dimethyl PABA. | | Definition | ChEBI: Padimate O is a benzoate ester. | | General Description | Padimate O is a tertiary amine derivative of p-aminobenzoic acid (PABA), which is commonly used as a sunscreen agent in cosmetics and other sunscreen formulations due to its ability to absorb ultraviolet radiations. | | Synthesis | Take p-dimethylaminobenzaldehyde 149g (1mol) dissolved in 600mL of toluene, keep the system temperature at 5 to 10??, then add 6.5g KH2PO4 and 100mL of water, stirring dropwise addition of NaClO2 (1.35mol, 122.2g) and 1,000mL prepared aqueous solution, 1.5h dropwise addition is completed, and then held for 3h, stirred and warmed to 25~30??C,
React for another 3h, TCL tracked the reaction. A 10% NaOH solution of 1000 mL was then added to the reaction mixture. this basic aqueous solution was extracted with trichloromethane (2 × 400 mL, 1 × 200 mL). The remaining aqueous solution was cooled down with an ice bath. The pH was adjusted to 2-3 with 4 mol/L hydrochloric acid, and the resulting solid was extracted and filtered, then washed with water and ethanol, respectively, and dried to yield 142 g of white solid material in 86% yield.
|
| | 2-Ethylhexyl 4-dimethylaminobenzoate Preparation Products And Raw materials |
|