- Artemisitene
-
- $96.00 / 1mg
-
2026-04-21
- CAS:101020-89-7
- Min. Order:
- Purity: 99.58%
- Supply Ability: 10g
|
| | artemisitene Basic information |
| Product Name: | artemisitene | | Synonyms: | artemisitene;(3R,5aS,6R,8aS,12S,12aR)-Octahydro-3,6-diMethyl-9-Methylene-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10(3H)-one;Dehydroqinghaosu;ArteMisitene (Methyl ArteMisinin);Methyl Artemisinin;Artemisinin and Piperaquine Tablets Impurity Ⅰ:(artemisitene)(3R,5aS,6R,8aS,12S,12aR)-Octahydro-3,6-diMethyl-9-Methylene-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10(3H)-oneChemicalBook;3,12-Epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10(3H)-one, octahydro-3,6-dimethyl-9-methylene-, (3R,5aS,6R,8aS,12S,12aR)-;Artemisiten | | CAS: | 101020-89-7 | | MF: | C15H20O5 | | MW: | 280.32 | | EINECS: | | | Product Categories: | Chiral Reagents;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 101020-89-7.mol |  |
| | artemisitene Chemical Properties |
| Melting point | 160-162°C | | Boiling point | 417.5±45.0 °C(Predicted) | | density | 1.26±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C15H20O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8,10-11,13H,2,4-7H2,1,3H3/t8-,10+,11+,13-,14-,15-/m1/s1 | | InChIKey | IGEBZMMCKFUABB-KPHNHPKPSA-N | | SMILES | O1[C@]23[C@@]4([H])O[C@@](C)(CC[C@@]2([H])[C@H](C)CC[C@@]3([H])C(=C)C(=O)O4)O1 | | LogP | 0.733 (est) |
| | artemisitene Usage And Synthesis |
| Uses | Artemisitene, the oxidized form of Artemisinin (A777500), exists as a minor constituent in an American variant of Artemisia annua. Artemisinin precursors are the important basic substances for biosynthesis of Artemisinin, including Artemisinic acid, Artemisinin B, Artemisitene, etc. An antimalarial agent. | | in vivo | In Nrf2 wild-type mice, systemic administration of Artemisitene (5-10 mg/kg; i.p.) strongly inhibits bleomycin-induced lung damage[1]. |
| | artemisitene Preparation Products And Raw materials |
|