| Company Name: |
Sichuan BioCrick Biotech Co., Ltd Gold
|
| Tel: |
28-86-28-8543-3893 13260669172 |
| Email: |
sales@biocrick.com |
| Products Intro: |
Product Name:Tetrahymanol
CAS:2130-17-8
Purity:98% HPLC Package:5mg;10mg;20mg;50mg……1g
|
| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:Tetrahymanol
CAS:2130-17-8
Purity:98.0% Package:5mg Remarks:BBP04438
|
tetrahymanol manufacturers
- Tetrahymanol
-
- $1269.00 / 5mg
-
2025-09-17
- CAS:2130-17-8
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | tetrahymanol Basic information |
| Product Name: | tetrahymanol | | Synonyms: | tetrahymanol;5α-Gammaceran-3β-ol;Wallichiniol;Gammaceran-3-ol, (3β)-;etrahymanol | | CAS: | 2130-17-8 | | MF: | C30H52O | | MW: | 428.73 | | EINECS: | | | Product Categories: | | | Mol File: | 2130-17-8.mol |  |
| | tetrahymanol Chemical Properties |
| Melting point | 310-312 °C | | Boiling point | 478.4±13.0 °C(Predicted) | | density | 0.958±0.06 g/cm3(Predicted) | | pka | 15.19±0.70(Predicted) | | InChIKey | BFNSRKHIVITRJP-VJHRKXFONA-N | | SMILES | C1[C@@]2(C)[C@@]([H])(CC[C@]3(C)[C@]2([H])CCC2[C@@]3(C)CC[C@]3([H])[C@]2(C)CCCC3(C)C)C(C)(C)[C@@H](O)C1 |&1:1,3,7,9,14,18,20,31,r| |
| | tetrahymanol Usage And Synthesis |
| Uses | Tetrahymanol is a pentacyclic triterpenoid that can be found in Tetrahymena pyriformis[1]. | | Definition | ChEBI: A pentacyclic triterpenoid having a 3beta- (21alpha-) hydroxy-substituted gammacerane structure. | | References | [1] Zander JM, et, al. The presence of tetrahymanol in Oleandra wallichii. Phytochemistry. Volume 8, Issue 11, November 1969, Pages 2265-2267. |
| | tetrahymanol Preparation Products And Raw materials |
|