| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:alpha-Amylcinnamaldehyde dimethyl acetal CAS:91-87-2 Purity:United States Pharmacopeia (USP) Reference Standard Package:500MG Remarks:1034498-500MG
|
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:alpha-amyl cinnamaldehyde dimethyl acetal CAS:91-87-2
|
| Company Name: |
TCI (Shanghai) Chemical Trading Co., Ltd.
|
| Tel: |
021-61109150 |
| Email: |
sales@tcisct.com |
| Products Intro: |
Product Name:(E)-2-(dimethoxymethyl)hept-1-enyl]benzene CAS:91-87-2 Purity:根据客户需求提供 Package:1KG;10KG;100KG;
|
|
| | FEMA 2062 Basic information |
| Product Name: | FEMA 2062 | | Synonyms: | FEMA 2062;[2-(dimethoxymethyl)-1-heptenyl]-benzen;[2-(dimethoxymethyl)-1-heptenyl]-Benzene;ALPHA-AMYL CINNAMIC ALDEHYDE DIMETHYL ACETAL;ALPHA-AMYLCINNAMALDEHYDE DIMETHYL ACETAL;ALPHA-N-AMYL CINNAMIC ALDEHYDE DIMETHYL ACETAL;AMYL CINNAMIC ALDEHYDE DIMETHYL ACETAL;2-dimethoxymethyl-1-phenylhept-1-ene | | CAS: | 91-87-2 | | MF: | C16H24O2 | | MW: | 248.36 | | EINECS: | 202-104-3 | | Product Categories: | A-B;Alphabetical Listings;Flavors and Fragrances | | Mol File: | 91-87-2.mol |  |
| | FEMA 2062 Chemical Properties |
| Boiling point | 300 °C(lit.) | | density | 0.959 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.508(lit.) | | FEMA | 2062 | ALPHA-AMYLCINNAMALDEHYDE DIMETHYL ACETAL | | Fp | >230 °F | | solubility | Almost insoluble in water, soluble in alcohol and perfume materials. | | Odor | at 100.00 %. bland jasmin lily green lemon | | Odor Type | floral | | JECFA Number | 681 | | Major Application | pharmaceutical (small molecule) | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C16H24O2/c1-4-5-7-12-15(16(17-2)18-3)13-14-10-8-6-9-11-14/h6,8-11,13,16H,4-5,7,12H2,1-3H3/b15-13+ | | InChIKey | QCHZKUPVENJLAW-FYWRMAATSA-N | | SMILES | CCCCC\C(=C/c1ccccc1)C(OC)OC | | LogP | 5.37 | | EPA Substance Registry System | Benzene, [2-(dimethoxymethyl)-1-heptenyl]- (91-87-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | GD6837500 | | TSCA | TSCA listed | | HS Code | 2911005000 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | FEMA 2062 Usage And Synthesis |
| Chemical Properties | α-Amylcinnamaldehyde dimethyl acetal has a floral note reminiscent of jasmine. | | Chemical Properties | Almost colorless slightly oily liquid, A yellouish tint or color usually indicates a significant content of the free aldehyde (ACA). Sp.Gr. 0.94. B.P. approx. 300℃. Almost insoluble in water, soluble in alcohol and perfume materials. Peculiar animal-green odor, mild and reminiscent of parts of the Jasmin complex, although not very floral unless composed with related Jasmin chemicals. The odor is strongly influenced by the presence of even minute amounts of free aldehyde. | | Uses | a-Amylcinnamaldehyde Dimethyl Acetal can be useful in the study of screening criteria for long-range transport potential of organic substances in water. | | Preparation |
α-Amylcinnamaldehyde dimethyl acetal is produced from Amylcinnamic aide Methyl alcohol by condensation.
|
| | FEMA 2062 Preparation Products And Raw materials |
|