- Transfluthrin
-
-
2026-01-22
- CAS:118712-89-3
- Min. Order:
- Purity: 0.99
- Supply Ability:
- Transfluthrin
-
- $0.00 / 1KG
-
2025-06-27
- CAS:118712-89-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- Transfluthrin
-
- $0.00 / 1kg
-
2025-06-20
- CAS:118712-89-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20tons
|
| | Transfluthrin Basic information | | Uses |
| Product Name: | Transfluthrin | | Synonyms: | TRANSFLUTHRIN;3-(2,2-dichloroethenyl)-2,2-dimethyl-cyclopropanecarboxylic acid (2,3,5,6-tetrafluorophenyl)methylester;2,3,5,6-tetrafluorobenzyl-(1r,s)-trans-3-(2,2-dichlorovinyl)-2, 2-dimethyl-cyclopropanecarboxylate;BAYOTHRIN;TRANSFUTHRIN PESTANAL, 250 MG;Transfluthrin [iso];Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (2,3,5,6-tetrafluorophenyl)methyl ester, (1R,3S)-;2,3,5,6-tetrafluorobenzyl trans-2-(2,2-dichlorovinyl)-3,3-dimethylcyclopropanecarboxylate | | CAS: | 118712-89-3 | | MF: | C15H12Cl2F4O2 | | MW: | 371.15 | | EINECS: | 405-060-5 | | Product Categories: | Alpha sort;Insecticides;Pesticides;PyrethroidsPesticides&Metabolites;Q-ZAlphabetic;TP - TZ | | Mol File: | 118712-89-3.mol |  |
| | Transfluthrin Chemical Properties |
| Melting point | 32 °C | | Boiling point | 135 °C(Press: 0.15 Torr) | | density | 1.492±0.06 g/cm3(Predicted) | | Fp | >35 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | Major Application | agriculture environmental | | InChI | 1S/C15H12Cl2F4O2/c1-15(2)7(3-10(16)17)11(15)14(22)23-5-6-12(20)8(18)4-9(19)13(6)21/h3-4,7,11H,5H2,1-2H3/t7-,11+/m1/s1 | | InChIKey | DDVNRFNDOPPVQJ-HQJQHLMTSA-N | | SMILES | FC1=C(F)C=C(F)C(F)=C1COC([C@H]2C(C)(C)[C@@H]2C=C(Cl)Cl)=O | | CAS DataBase Reference | 118712-89-3(CAS DataBase Reference) | | EPA Substance Registry System | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (2,3,5,6-tetrafluorophenyl)methyl ester, (1R,3S)- (118712-89-3) |
| Hazard Codes | Xi;N,N,Xi | | Risk Statements | 38-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3077 | | WGK Germany | 2 | | HS Code | 29162090 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 |
| | Transfluthrin Usage And Synthesis |
| Uses | Transfluthrin is a fluorinated aromatic compound for proteomics research. | | Uses | Transfluthrin is a fluorinated aromatic compound for proteomics research. | | Definition | ChEBI: A carboxylic ester obtained by formal condensation of 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid and 2,3,5,6-tetrafluorobenzyl alcohol. |
| | Transfluthrin Preparation Products And Raw materials |
|