|
| Ethyl 2-methylthiazole-4-carboxylate Basic information |
| Ethyl 2-methylthiazole-4-carboxylate Chemical Properties |
Melting point | 54-58 °C | Boiling point | 242.1±13.0 °C(Predicted) | density | 1.198±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | form | solid | pka | 1.10±0.10(Predicted) | InChI | InChI=1S/C7H9NO2S/c1-3-10-7(9)6-4-11-5(2)8-6/h4H,3H2,1-2H3 | InChIKey | QWWPUBQHZFHZSF-UHFFFAOYSA-N | SMILES | S1C=C(C(OCC)=O)N=C1C | CAS DataBase Reference | 6436-59-5(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-37-24/25 | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 29341000 |
Provider | Language |
ALFA
| English |
| Ethyl 2-methylthiazole-4-carboxylate Usage And Synthesis |
Chemical Properties | light yellowto brownpowde | Uses | Ethyl 2-methylthiazole-4-carboxylate is a reactant used in the synthesis of 2,?4,?5-?trisubstituted thiazoles as antituberculosis agents effective against drug resistant tuberculosis. |
| Ethyl 2-methylthiazole-4-carboxylate Preparation Products And Raw materials |
|