1-(4-hydroxy-2-methoxyphenyl)ethanone manufacturers
|
| | 1-(4-hydroxy-2-methoxyphenyl)ethanone Basic information | | Uses |
| Product Name: | 1-(4-hydroxy-2-methoxyphenyl)ethanone | | Synonyms: | 1-(4-hydroxy-2-methoxyphenyl)ethanone;Isopeonol;1-(4-Hydroxy-2-methoxyphenyl)ethan-1-one, 4-Acetyl-3-methoxyphenol;1-(4-Hydroxy-2-methoxyphenyl)ethan-1-one;Ethanone, 1-(4-hydroxy-2-methoxyphenyl)-;4-HYDROXY-2-METHOXYACETOPHENONE（WS204372） | | CAS: | 493-33-4 | | MF: | C9H10O3 | | MW: | 166.17 | | EINECS: | | | Product Categories: | | | Mol File: | 493-33-4.mol |  |
| | 1-(4-hydroxy-2-methoxyphenyl)ethanone Chemical Properties |
| Melting point | 138 °C(Solv: water (7732-18-5)) | | Boiling point | 329.9±22.0 °C(Predicted) | | density | 1.158±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder | | pka | 7.79±0.18(Predicted) | | color | Off-white to beige | | InChI | InChI=1S/C9H10O3/c1-6(10)8-4-3-7(11)5-9(8)12-2/h3-5,11H,1-2H3 | | InChIKey | XPHIPEXPAGCEBM-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(O)C=C1OC)C |
| | 1-(4-hydroxy-2-methoxyphenyl)ethanone Usage And Synthesis |
| Uses | 1-(4-hydroxy-2-methoxyphenyl)ethenone is an important organic building block to synthetize substituted methoxyphenyl products.
| | Uses | 1-(4-Hydroxy-2-methoxyphenyl)ethanone can be used to treat lymphedema. | | Preparation | Preparation by reaction of acetonitrile on resorcinol monomethyl ether (Hoesch reaction) (27%). | | Definition | ChEBI: 1-(4-Hydroxy-2-methoxyphenyl)ethanone is an aromatic ketone. |
| | 1-(4-hydroxy-2-methoxyphenyl)ethanone Preparation Products And Raw materials |
|