|
|
| | 4-Chloro-3-fluorobenzaldehyde Basic information |
| | 4-Chloro-3-fluorobenzaldehyde Chemical Properties |
| Melting point | 46-49 °C (lit.) | | Boiling point | 201.5°C (rough estimate) | | density | 1.3310 (estimate) | | Fp | 206 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Solid | | color | White to yellow | | Water Solubility | Insoluble | | Sensitive | Air Sensitive | | InChI | InChI=1S/C7H4ClFO/c8-6-2-1-5(4-10)3-7(6)9/h1-4H | | InChIKey | AZMDWRPTDCIFRD-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(Cl)C(F)=C1 | | CAS DataBase Reference | 5527-95-7(CAS DataBase Reference) |
| | 4-Chloro-3-fluorobenzaldehyde Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 4-Chloro-3-fluorobenzaldehyde is an organic intermediate that can be prepared from 4-chloro-3-fluoroiodobenzene in one step. It has been reported in the literature that it can be used to prepare piperidine derivatives. |
| | 4-Chloro-3-fluorobenzaldehyde Preparation Products And Raw materials |
|