|
|
| | METHYL 3,3-DIMETHOXYPROPIONATE Basic information |
| Product Name: | METHYL 3,3-DIMETHOXYPROPIONATE | | Synonyms: | 3,3-DIMETHOXYPROPIONIC ACID METHYL ESTER;Propanoic acid, 3,3-dimethoxy-, methyl ester;malonaldehydic acid dimethyl acetal methyl ester;3,3-DIMETHOXYPROPIONIC ACID METHYL ESTER 95+%;Methyl 3,3-dimethoxypropionate,99%;Mthyl 3,3-dimethoxypropionate;Methyl 3,3-diMethoxypropionate, 99% 25GR;Methyl 3,3-dimethoxypropionate, (Methoxycarbonyl)acetaldehyde dimethyl acetal | | CAS: | 7424-91-1 | | MF: | C6H12O4 | | MW: | 148.16 | | EINECS: | 231-055-0 | | Product Categories: | C6 to C7;Carbonyl Compounds;Esters | | Mol File: | 7424-91-1.mol |  |
| | METHYL 3,3-DIMETHOXYPROPIONATE Chemical Properties |
| Boiling point | 77 °C/20 mmHg (lit.) | | density | 1.045 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.41(lit.) | | Fp | 150 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Liquid | | color | Clear colorless | | BRN | 1561517 | | InChI | InChI=1S/C6H12O4/c1-8-5(7)4-6(9-2)10-3/h6H,4H2,1-3H3 | | InChIKey | SMCVPMKCDDNUCQ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CC(OC)OC | | CAS DataBase Reference | 7424-91-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | HS Code | 29189900 | | Storage Class | 10 - Combustible liquids |
| | METHYL 3,3-DIMETHOXYPROPIONATE Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | Methyl β,β-Dimethoxypropionate is used as a reactant in the preparation of tetrahydro-β-carboline derivatives as antitumor growth and metastasis agents. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 50, p. 4157, 1985 DOI: 10.1021/jo00221a038 | | General Description | Methyl 3,3-dimethoxypropionate was used in the synthesis of 3-indolyl α,β-unsaturated carbonyl compounds. |
| | METHYL 3,3-DIMETHOXYPROPIONATE Preparation Products And Raw materials |
| Raw materials | Dimethyl malonate-->1,4-Cyclohexadiene, (1E,4Z)--->2-Pentene, 1,1,5,5-tetramethoxy--->1,1,2,2-Tetramethoxyethane-->Methyl dimethoxyacetate-->TRIMETHYL 1,3,5-BENZENETRICARBOXYLATE-->Methanol-->acrylic acid methyl ester | | Preparation Products | METHYL 2-FORMYL-3-OXO-PROPIONATE-->3-Quinolinecarboxylic acid, 6-broMo-, Methyl ester-->Cyclopropanol, 1-(2,2-dimethoxyethyl)--->3-Furancarboxylicacid,5-methyl-,methylester(9CI) |
|