- Dibenzoyl-L-tartaric acid
-
- $100.00
-
2026-07-09
- CAS:2743-38-6
- Min. Order: 1kg
- Purity: 99.0%min HPLC
- Supply Ability: 10tons/month
|
| | Dibenzoyl-L-tartaric acid Basic information |
| | Dibenzoyl-L-tartaric acid Chemical Properties |
| Melting point | 152-155 °C(lit.) | | Boiling point | 234 °C / 7mmHg | | density | 1.3806 (rough estimate) | | vapor pressure | 0Pa at 20℃ | | refractive index | -116 ° (C=1, EtOH) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | 1.85±0.25(Predicted) | | form | Solid or Crystalline Powder | | color | Off-white to orange to pale brown | | Optical Rotation | [α]20/D 116°, c = 9 in ethanol | | Water Solubility | Slightly soluble in water. | | BRN | 709854 | | InChI | 1S/C18H14O8/c19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12/h1-10,13-14H,(H,19,20)(H,21,22)/t13-,14-/m1/s1 | | InChIKey | YONLFQNRGZXBBF-ZIAGYGMSSA-N | | SMILES | OC(=O)[C@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c2ccccc2)C(O)=O | | LogP | 1.01 at 20℃ | | CAS DataBase Reference | 2743-38-6(CAS DataBase Reference) | | EPA Substance Registry System | Butanedioic acid, 2,3-bis(benzoyloxy)-, (2R,3R)- (2743-38-6) |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | WW8070000 | | F | 3-9 | | TSCA | TSCA listed | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1
Skin Sens. 1 |
| | Dibenzoyl-L-tartaric acid Usage And Synthesis |
| Description | Dibenzoyl-L-tartaric acid is a kind of white crystalline powder, and odorless, mildly bitter flavor, be slightly soluble in water, and pH value is 3-4, in acid, dissolves in ethanol and acetone and other organic solvent. Be widely used in chiral separation of racemic amine compounds. Because it is cheap, has stable properties, and is easy to recycle, it has good industrial application value. | | Chemical Properties | Dibenzoyl-L-tartaric acid is white to light yellow crystal powde | | Uses | (-)-Dibenzoyl-L-tartaric acid, anhydrous is used as a reagent used to produce chiral salts. Also used as organic chemical synthesis intermediate. | | Application |
Dibenzoyl-L-tartaric acid plays a crucial role in the resolution of chiral compounds, particularly in the separation of enantiomers of racemic mixtures.
| | Flammability and Explosibility | Not classified | | Safety Profile | Dibenzoyl-L-tartaric acid is an eye irritant. When heated to decomposition it emits acrid smoke and irritating fumes. | | Synthesis | A synthetic method of Dibenzoyl-L-tartaric acid includes the following steps: with L-tartaric acid and benzoyl chloride as raw materials, copper sulfate as a catalyst and toluene as a solvent, carrying out reaction to prepare L-dibenzoyl tartaric anhydride, carrying out hydrolysis with an equal amount of water and toluene to obtain the L-dibenzoyl tartaric acid, wherein the toluene serving as the solvent, as well as the water and the toluene in the hydrolysis step, can be repeatedly utilized.
| | References | [1] Patent: CN104496806, 2016, B. Location in patent: Paragraph 0099-0102
[2] Journal of Chemical Research, Miniprint, 1984, # 5, p. 1518 - 1530 |
| | Dibenzoyl-L-tartaric acid Preparation Products And Raw materials |
|