| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Nsc290127 Basic information |
| Product Name: | Nsc290127 | | Synonyms: | Nsc290127;Oxaliplatin Related Compound F (25 mg) ([SP-4-2-(1R-trans)]-(1,2-cyclohexanediamine-N,N') diiodidoplatinum(II));Oxaliplatin Related CoMpound F;Diiodo(trans-l-1,2-cyclohexanediamine)platinum;(trans-R,R-1,2-Diaminocyclohexane)diiodoplatinum;(trans-1R,2R-1,2-Diaminocyclohexane)diiodoplatinum;[SP-4-2-(1R-trans)]-(1,2-Cyclohexanediamine-κN,κN') Diiodoplatinum;Oxaliplatin Related Compound F (25 mg) | | CAS: | 66845-32-7 | | MF: | C6H14I2N2Pt | | MW: | 563.0757 | | EINECS: | | | Product Categories: | | | Mol File: | 66845-32-7.mol |  |
| | Nsc290127 Chemical Properties |
| Melting point | >300°C | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly) | | form | Solid | | color | Light Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C6H12N2.2HI.Pt/c7-5-3-1-2-4-6(5)8;;;/h5-8H,1-4H2;2*1H;/q-2;;;+4/p-2 | | InChIKey | KEZVWGKGXZSYRH-UHFFFAOYSA-L | | SMILES | [Pt+2](I)I.[N-H]C1C(CCCC1)[N-H] |
| WGK Germany | WGK 3 | | HS Code | 2843900000 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Carc. 2
Eye Dam. 1
Lact.
Muta. 2
Repr. 1B
Resp. Sens. 1B
Skin Sens. 1
STOT RE 1 |
| | Nsc290127 Usage And Synthesis |
| Uses | [SP-4-2-(1R-trans)]-(1,2-Cyclohexanediamine-κN,κN'')diiodoplatinum is a potential antitumor agent. Impurity of Oxiplatin (O845075), third generation platinum complex. An antitumor agent with activity against colorectal cancer. Cytotoxicity follows the formation of adducts with DNA. Antineoplastic. |
| | Nsc290127 Preparation Products And Raw materials |
|