|
|
| | 2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine Basic information |
| Product Name: | 2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine | | Synonyms: | 2,4-bis(Trichloromethyl)-6-p-methoxystyryl-s-triazine;3,5-Triazine,2-[2-(4-methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1;5-triazine,2-[2-(4-methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-3;PINA(R) PHOTO ADDITIVE TRIAZINE MOP;2-(p-methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine;2-(4-METHOXYSTYRYL)-4,6-BIS (TRICHLOROME;2-[2-(4-Methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)-1,3,5-triazine;4,6-Bis-(trichloromethyl)-2-(4-methoxystyryl)-1,3,5-triazine | | CAS: | 42573-57-9 | | MF: | C14H9Cl6N3O | | MW: | 447.96 | | EINECS: | 255-893-1 | | Product Categories: | Cationic PhotoinitiatorsSelf Assembly&Contact Printing;Organic Photoinitiators;Photoacid Generators (PAGs);Photoresists;Polymerization Initiators | | Mol File: | 42573-57-9.mol |  |
| | 2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine Chemical Properties |
| Melting point | 192-195 °C (lit.) | | Boiling point | 511.4±60.0 °C(Predicted) | | density | 1.605 | | pka | -1.88±0.10(Predicted) | | form | powder to crystal | | color | Light yellow to Amber to Dark green | | InChI | InChI=1S/C14H9Cl6N3O/c1-24-9-5-2-8(3-6-9)4-7-10-21-11(13(15,16)17)23-12(22-10)14(18,19)20/h2-7H,1H3 | | InChIKey | MCNPOZMLKGDJGP-UHFFFAOYSA-N | | SMILES | N1=C(C(Cl)(Cl)Cl)N=C(C(Cl)(Cl)Cl)N=C1C=CC1=CC=C(OC)C=C1 | | EPA Substance Registry System | 1,3,5-Triazine, 2-[2-(4-methoxyphenyl)ethenyl]-4,6-bis(trichloromethyl)- (42573-57-9) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29336990 |
| | 2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine Usage And Synthesis |
| Uses | Cationic photoinitiator. Nonionic photoacid generator. | | Properties and Applications | 2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine (R–Cl) appears as a versatile high-performance photoinitiator (PI) under LED exposure at 385, 395, or 405 nm (intensities in the range ～9–140 mW cm?2). It can be used as an efficient Type I cleavable photoinitiator for free radical polymerization of (meth)acrylates upon LED (e.g., 405 nm) exposure. Its high FRP photoinitiation ability under air demonstrates its capability to reduce the oxygen inhibition effect. Moreover, the R–Cl/amine (or R–Cl/N-vinylcarbazole) two-component system exhibits a higher photoinitiation ability than R–Cl alone in some cases. R–Cl/Iod/NVK is also efficient for the cationic photopolymerization of epoxides, especially at 405 nm[1]. | | References | [1] Zhang, Jing et al. “A known photoinitiator for a novel technology: 2-(4-methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine for near UV or visible LED?.” Polymer Chemistry 20 (2014): 6019–6026. |
| | 2-(4-Methoxystyryl)-4,6-bis(trichloromethyl)-1,3,5-triazine Preparation Products And Raw materials |
|