- Diphosphoryl chloride
-
- $0.00 / 25KG
-
2025-11-06
- CAS:13498-14-1
- Min. Order: 25KG
- Purity: 98%min
- Supply Ability: 30tons/month
- Pyrophosphoryl Chloride
-
- $15000.00 / 1000KG
-
2025-10-14
- CAS:13498-14-1
- Min. Order: 100g
- Purity: ＞99%
- Supply Ability: 100 tons
- Pyrophosphoryl Chloride
-
- $6.00 / 1KG
-
2025-09-25
- CAS:13498-14-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | Diphosphoryl chloride Basic information |
| | Diphosphoryl chloride Chemical Properties |
| Melting point | <-50°C | | Boiling point | 90 °C12 mm Hg(lit.) | | density | 1.82 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.476 | | Fp | 101°C/10mm | | storage temp. | −20°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colorless to pale yellow | | Specific Gravity | 1.82 | | Water Solubility | Reacts violently with waterMiscible with most organic solvents. | | Sensitive | Air & Moisture Sensitive | | InChI | InChI=1S/Cl4O3P2/c1-8(2,5)7-9(3,4)6 | | InChIKey | CNTIXUGILVWVHR-UHFFFAOYSA-N | | SMILES | P(Cl)(Cl)(OP(Cl)(Cl)=O)=O | | CAS DataBase Reference | 13498-14-1(CAS DataBase Reference) |
| | Diphosphoryl chloride Usage And Synthesis |
| Chemical Properties | Diphosphoryl chloride is a colorless liquid that produces smoke upon exposure to air and reacts violently with water. At temperatures as low as -30°C, it can react with water to form dichlorophosphoric acid (HPO2C12). The compound is soluble in a variety of solvents, including phosphorus trichloride, phosphorus oxychloride, thionyl chloride, benzene, other hydrocarbons, ether, and nitrobenzene. | | Uses | Pyrophosphoryl chloride serves as a reductive chlorination reagent used in the synthesis of quetiapine. It acts as a phosphorylating agent involved in nucleoside synthesis. It plays an important role in Vilsmeier formylation and glyoxylation reactions. | | reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | Diphosphoryl chloride Preparation Products And Raw materials |
|