| Company Name: |
DKMbiochem.Co. Ltd
|
| Tel: |
15901859516 |
| Email: |
sales@DKMbiochem.com |
| Products Intro: |
Product Name:5-tert-butyl-2-iodophenol CAS:20942-70-5 Purity:95 Package:10g,50g
|
|
| | 5-tert-butyl-2-iodophenol Basic information |
| | 5-tert-butyl-2-iodophenol Chemical Properties |
| Melting point | 48-49 °C(Solv: pentane (109-66-0)) | | Boiling point | 250.7±28.0 °C(Predicted) | | density | 1.563±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 8?+-.0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C10H13IO/c1-10(2,3)7-4-5-8(11)9(12)6-7/h4-6,12H,1-3H3 | | InChIKey | COYVTCLXNSGLFE-UHFFFAOYSA-N | | SMILES | C1(O)=CC(C(C)(C)C)=CC=C1I |
| | 5-tert-butyl-2-iodophenol Usage And Synthesis |
| | 5-tert-butyl-2-iodophenol Preparation Products And Raw materials |
|