|
|
| | Ethyl 3-methyl-2-oxobutyrate Basic information |
| | Ethyl 3-methyl-2-oxobutyrate Chemical Properties |
| Boiling point | 62 °C/11 mmHg (lit.) | | density | 0.989 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.410(lit.) | | Fp | 110 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear light yellow | | Water Solubility | Slightly soluble in water. | | BRN | 1756668 | | InChI | InChI=1S/C7H12O3/c1-4-10-7(9)6(8)5(2)3/h5H,4H2,1-3H3 | | InChIKey | CKTYYUQUWFEUCO-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(=O)C(C)C |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | UN 3272 3/PG 3 | | WGK Germany | 3 | | HazardClass | 3.2 | | PackingGroup | III | | HS Code | 29183000 |
| | Ethyl 3-methyl-2-oxobutyrate Usage And Synthesis |
| Chemical Properties | clear light yellow liquid | | Uses | Ethyl dimethylpyruvate is used as an allyl halide reactant in the presence of indium to release hydroxy unsaturated carbonyl compounds. It was also used in the synthesis of (2SR,4SR)-5(S)-(N-Boc)-amino-6-cyclohexyl-4-hydoxy-2-isopropyl hexanoic acid. | | Uses | Ethyl 3-methyl-2-oxobutyrate was used in the synthesis of (2SR,4SR)-5(S)-(N-Boc)-amino-6-cyclohexyl-4-hydoxy-2-isopropyl hexanoic acid. | | General Description | Ethyl 3-methyl-2-oxobutyrate reacts with a variety of allyl halides in the presence of indium to afford hydroxy unsaturated carbonyl compounds. Conformational behaviour of ethyl 3-methyl-2-oxobutyrate was investigated using solution FTIR in combination with ab initio calculations. |
| | Ethyl 3-methyl-2-oxobutyrate Preparation Products And Raw materials |
|