| Company Name: |
Capot Chemical Co.,Ltd. |
| Tel: |
571-85586718 +8613336195806 |
| Email: |
sales@capotchem.com |
| Products Intro: |
Product Name:1-Boc-4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine
CAS:286961-14-6
Purity:98% Min. Package:100g;1kg;5kg,10kg,25kg,50kg
|
|
|
|
|
|
| | N-Boc-1,2,5,6-tetrahydropyridine-4-boronic acid pinacol ester Basic information |
| Product Name: | N-Boc-1,2,5,6-tetrahydropyridine-4-boronic acid pinacol ester | | Synonyms: | N-BOC-1,2,5,6-TETRAHYDROPYRIDINE-4-(PINACOLATO)BORONATE;(N-TERT-BUTOXYCARBONYL)-1,2,3,6-TETRAHYDROPYRIDINE-4-BORONIC ACID PINACOL ESTER;4-(4,4,5,5-TETRAMETHYL-[1,3,2]-DIOXABOROLAN-2-YL)-3,6-DIHYDRO-2H-PYRIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;3,6-DIHYDRO-2H-PYRIDINE-1-TERT-BUTOXYCARBONYL-4-BORONIC ACID, PINACOL ESTER;1-N-BOC-4-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-3,6-DIHYDRO-2H-PYRIDINE;1-N-BOC-4-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-3,6-DIHYDRO-2H-PYRIDINE 98+%;N-Boc-1,2,5,6-tetrahydropyridine-4-boronic acid pinacol ester;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine-1-carboxylate | | CAS: | 286961-14-6 | | MF: | C16H28BNO4 | | MW: | 309.21 | | EINECS: | 689-148-0 | | Product Categories: | API intermediates;Organoborons;Pyridine | | Mol File: | 286961-14-6.mol |  |
| | N-Boc-1,2,5,6-tetrahydropyridine-4-boronic acid pinacol ester Chemical Properties |
| Melting point | 114.0 to 118.0 °C | | Boiling point | 348.0±52.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Dichloromethane (Sparingly), DMSO (Slightly) | | form | Solid | | pka | -1.21±0.40(Predicted) | | color | white to off-white | | Water Solubility | Soluble in most organic solvents. Insoluble in water. | | InChI | InChI=1S/C16H28BNO4/c1-14(2,3)20-13(19)18-10-8-12(9-11-18)17-21-15(4,5)16(6,7)22-17/h8H,9-11H2,1-7H3 | | InChIKey | VVDCRJGWILREQH-UHFFFAOYSA-N | | SMILES | C1N(C(OC(C)(C)C)=O)CC=C(B2OC(C)(C)C(C)(C)O2)C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37-60 | | WGK Germany | 3 | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29349990 |
| | N-Boc-1,2,5,6-tetrahydropyridine-4-boronic acid pinacol ester Usage And Synthesis |
| Chemical Properties | off-white powder | | Uses | Reagent used for suzuki-Miyaura cross-coupling using palladium phosphine catalyst, palladium-catalyzed ligand-controlled regioselective Suzuki coupling, wrenchnolol derivative optimized for gene activation in cells. Also used in Preparation of several enzymatic inhibitors and receptor ligands, orally active anaplastic lymphoma kinase inhibitors and oxazolecarboxamides as diacylglycerol acyltransferase-1 inhibitors for treatment of obesity and diabetes. | | Uses | N-Boc-1,2,5,6-tetrahydropyridine-4-boronic acid pinacol ester is an intermediate for organic synthesis and pharmaceutical research and development, and can be used for suzuki reaction. |
| | N-Boc-1,2,5,6-tetrahydropyridine-4-boronic acid pinacol ester Preparation Products And Raw materials |
|