| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Phthalic Acid-d4 CAS:87976-26-9 Package:100Mg,1g,2.5g
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Phthalic-3,4,5,6-d4 acid CAS:87976-26-9 Purity:>=98 atom % D, >=98% (CP) Package:5G Remarks:318027-5G
|
| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:Phthalic Acid-d4 CAS:87976-26-9 Purity:98% Package:1g Remarks:Y18167
|
|
| | PHTHALIC ACID (RING-D4) Basic information |
| | PHTHALIC ACID (RING-D4) Chemical Properties |
| Melting point | 210-211 °C(lit.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | 1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12)/i1D,2D,3D,4D | | InChIKey | XNGIFLGASWRNHJ-RHQRLBAQSA-N | | SMILES | [2H]c1c([2H])c([2H])c(C(O)=O)c(c1[2H])C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 |
| | PHTHALIC ACID (RING-D4) Usage And Synthesis |
| Chemical Properties | PHTHALIC ACID (RING-D4) is White Solid | | Uses | PHTHALIC ACID (RING-D4) is used to synthesize phthalates. | | Uses | Labelled Phthalic Acid (P384480). Organic reagent used to synthesize phthalates. | | Uses | Labelled Phthalic Acid Organic reagent used to synthesize phthalates. |
| | PHTHALIC ACID (RING-D4) Preparation Products And Raw materials |
|