| Company Name: |
Chengdu Ainahua Chemicals Co., Ltd. Gold
|
| Tel: |
028-86612776; 13699069380 |
| Email: |
515238037@qq.com |
| Products Intro: |
Product Name:(4-(Methylamino)phenyl)methanol CAS:181819-75-0 Purity:98% Package:1g;2g Remarks:HN
|
| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 4008675858 |
| Email: |
sales@amateksci.com |
| Products Intro: |
Product Name:4-(Methylamino)benzenemethanol CAS:181819-75-0 Purity:97% HPLC Package:1g;5g;25g;100g
|
(4-(methylamino)phenyl)methanol manufacturers
|
| | (4-(methylamino)phenyl)methanol Basic information |
| | (4-(methylamino)phenyl)methanol Chemical Properties |
| Melting point | 68-70 °C(Solv: benzene (71-43-2)) | | Boiling point | 282.4±23.0 °C(Predicted) | | density | 1.117±0.06 g/cm3(Predicted) | | pka | 14.89±0.10(Predicted) | | InChI | InChI=1S/C8H11NO/c1-9-8-4-2-7(6-10)3-5-8/h2-5,9-10H,6H2,1H3 | | InChIKey | DGPBXQNDKIZRIJ-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(NC)C=C1 |
| | (4-(methylamino)phenyl)methanol Usage And Synthesis |
| | (4-(methylamino)phenyl)methanol Preparation Products And Raw materials |
|