|
| (R)-(-)-1-METHOXY-2-PROPANOL Basic information |
| (R)-(-)-1-METHOXY-2-PROPANOL Chemical Properties |
Melting point | -97 °C | Boiling point | 119-121 °C (lit.) | density | 0.921 g/mL at 20 °C (lit.) | refractive index | n20/D 1.403 | Fp | 33 °C | storage temp. | Sealed in dry,2-8°C | pka | 14.49±0.20(Predicted) | form | Liquid | color | Clear colorless | Optical Rotation | [α]20/D 22±2°, c = 10% in chloroform | BRN | 1718941 | InChI | InChI=1S/C4H10O2/c1-4(5)3-6-2/h4-5H,3H2,1-2H3/t4-/m1/s1 | InChIKey | ARXJGSRGQADJSQ-SCSAIBSYSA-N | SMILES | C(OC)[C@H](O)C | CAS DataBase Reference | 4984-22-9(CAS DataBase Reference) |
Hazard Codes | F,Xn | Risk Statements | 10-15 | Safety Statements | 24-43-7/8 | RIDADR | UN 3092 3/PG 3 | WGK Germany | 1 | HazardClass | 3 | PackingGroup | Ⅲ | HS Code | 29051990 |
| (R)-(-)-1-METHOXY-2-PROPANOL Usage And Synthesis |
Chemical Properties | Colorless to light yellow liqui | Uses | (R)-(-)-1-Methoxy-2-propanol can be used as a reactant to prepare:
- (S)-3-(ethoxycarbonyl)-5-((1-methoxypropan-2-yl)oxy)benzoic acid, a key intermediate to synthesize phenylethyl benzamide derivatives, which can be used as glucokinase activators.
- Chiral pyrazolopyrimidinone derivatives as potential phosphodiesterase enzyme (PDE5) inhibitors.
- Aryl or alkyl ethers via etherification reaction.
| General Description | (R)-(-)-1-Methoxy-2-propanol is a chiral secondary alcohol. It is formed during the hydrolysis of (R)-1-methoxy-2-propyl-acetate in the presence of Candida antarctica lipase B. |
| (R)-(-)-1-METHOXY-2-PROPANOL Preparation Products And Raw materials |
|