|
| 5-Chloro-2-methoxyphenylboronic acid Basic information |
| 5-Chloro-2-methoxyphenylboronic acid Chemical Properties |
Melting point | 134-141 °C(lit.) | Boiling point | 360.2±52.0 °C(Predicted) | density | 1.32±0.1 g/cm3(Predicted) | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | pka | 7.58±0.58(Predicted) | form | Crystalline Powder | color | White | InChI | InChI=1S/C7H8BClO3/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4,10-11H,1H3 | InChIKey | FMBVAOHFMSQDGT-UHFFFAOYSA-N | SMILES | B(C1=CC(Cl)=CC=C1OC)(O)O | CAS DataBase Reference | 89694-48-4(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36/37/39 | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 29163990 |
| 5-Chloro-2-methoxyphenylboronic acid Usage And Synthesis |
Chemical Properties | White to off-white powder | Uses | Reactant for:• ;Boron-Heck arylation1• ;Suzuki-Miyaura reaction2 | Uses | suzuki reaction |
| 5-Chloro-2-methoxyphenylboronic acid Preparation Products And Raw materials |
|