4-(2-KETO-1-BENZIMIDAZOLINYL)PIPERIDINE manufacturers
|
| | 4-(2-KETO-1-BENZIMIDAZOLINYL)PIPERIDINE Basic information |
| | 4-(2-KETO-1-BENZIMIDAZOLINYL)PIPERIDINE Chemical Properties |
| Melting point | 183-185 °C (lit.) | | Boiling point | 357.82°C (rough estimate) | | density | 1.1005 (rough estimate) | | refractive index | 1.5290 (estimate) | | storage temp. | 2-8°C, protect from light | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 12.06±0.30(Predicted) | | form | Powder | | color | Off-white to slightly yellow | | InChI | InChI=1S/C12H15N3O/c16-12-14-10-3-1-2-4-11(10)15(12)9-5-7-13-8-6-9/h1-4,9,13H,5-8H2,(H,14,16) | | InChIKey | BYNBAMHAURJNTR-UHFFFAOYSA-N | | SMILES | C1(=O)N(C2CCNCC2)C2=CC=CC=C2N1 | | CAS DataBase Reference | 20662-53-7(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-36-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | HazardClass | 6.1 | | HS Code | 29333999 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-(2-KETO-1-BENZIMIDAZOLINYL)PIPERIDINE Usage And Synthesis |
| Chemical Properties | off-white to slightly yellow powder | | Uses | 4-(2-Keto-1-benzimidazolinyl)piperidine was used to study the structure–activity relationships with several potent and selective analogues. |
| | 4-(2-KETO-1-BENZIMIDAZOLINYL)PIPERIDINE Preparation Products And Raw materials |
|