|
|
| | 3-(4-Chlorophenyl)propanoic acid Basic information |
| | 3-(4-Chlorophenyl)propanoic acid Chemical Properties |
| Melting point | 127-131 °C (lit.) | | Boiling point | 263.86°C (rough estimate) | | density | 1.1989 (rough estimate) | | refractive index | 1.5242 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.61(at 25℃) | | form | solid | | color | White to off white | | InChI | InChI=1S/C9H9ClO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6H2,(H,11,12) | | InChIKey | BBSLOKZINKEUCR-UHFFFAOYSA-N | | SMILES | C1(CCC(O)=O)=CC=C(Cl)C=C1 | | CAS DataBase Reference | 2019-34-3(CAS DataBase Reference) | | NIST Chemistry Reference | 3-(4-Chlorophenyl)propionic acid(2019-34-3) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-41 | | Safety Statements | 26-36/37/39 | | WGK Germany | 2 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 3-(4-Chlorophenyl)propanoic acid Usage And Synthesis |
| Chemical Properties | White to off-white solid |
| | 3-(4-Chlorophenyl)propanoic acid Preparation Products And Raw materials |
|