|
|
| | 1,2,3,4-TETRAHYDRO-ISOQUINOLIN-6-OL Basic information |
| Product Name: | 1,2,3,4-TETRAHYDRO-ISOQUINOLIN-6-OL | | Synonyms: | 1,2,3,4-tetrahydro-6-isoquinolino;1,2,3,4-TETRAHYDRO-ISOQUINOLIN-6-OL;6-HYDROXY-1,2,3,4-TETRAHYDRO-ISOQUINOLINE;1,2,3,4-Tetrahydro-6-isoquinolinol;H90100;6-Isoquinolinol, 1,2,3,4-tetrahydro-;6-hydroxy-1,2,3,4-Tetrahydroisoquinoline HCl;1,2,3,4-Tetrahydroisoquinolin-6-ol Name | | CAS: | 14446-24-3 | | MF: | C9H11NO | | MW: | 149.19 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 14446-24-3.mol |  |
| | 1,2,3,4-TETRAHYDRO-ISOQUINOLIN-6-OL Chemical Properties |
| Melting point | 192-193℃ | | Boiling point | 313.5±42.0 °C(Predicted) | | density | 1.141±0.06 g/cm3(Predicted) | | RTECS | NX5898000 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | Solid | | pka | 9.30±0.20(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C9H11NO/c11-9-2-1-8-6-10-4-3-7(8)5-9/h1-2,5,10-11H,3-4,6H2 | | InChIKey | SCMZIFSYPJICCV-UHFFFAOYSA-N | | SMILES | C1C2=C(C=C(O)C=C2)CCN1 | | CAS DataBase Reference | 14446-24-3(CAS DataBase Reference) |
| | 1,2,3,4-TETRAHYDRO-ISOQUINOLIN-6-OL Usage And Synthesis |
| Chemical Properties | Pale yellow liquid | | Uses | 1,2,3,4-Tetrahydroisoquinolin-6-ol is a chemical reagent used in the organic synthesis. Used in the preparation of androgen receptor modulators (SARMs) as well as steroidmimetic and chimeric microtubule disruptors. |
| | 1,2,3,4-TETRAHYDRO-ISOQUINOLIN-6-OL Preparation Products And Raw materials |
|