|
|
| | 3-Amino-2-chlor-6-methylphenol Basic information |
| Product Name: | 3-Amino-2-chlor-6-methylphenol | | Synonyms: | 4-Amino-3-chloro-2-hydroxytoluene;5-AMINO-6-CHLORO-ORTHO-CRESOL;2-Chloro-4-methyl-3-hydroxyaniline;5-AMINO-6-CHLORO-2-METHYLPHENOL (5-AMINO-6-CHLORO-O-CRESOL);3-Amino-2-Chloro-6-Cresol;6-Chloro-5-amino-2-methyl phenol;4-Amino-3-chloro-2-hydroxytoluene, 2-Chloro-3-hydroxy-4-methylaniline, 5-Amino-6-chloro-o-cresol;CAOC | | CAS: | 84540-50-1 | | MF: | C7H8ClNO | | MW: | 157.6 | | EINECS: | 283-144-9 | | Product Categories: | Phenol&Thiophenol&Mercaptan;Aromatic Phenols | | Mol File: | 84540-50-1.mol |  |
| | 3-Amino-2-chlor-6-methylphenol Chemical Properties |
| Melting point | 80-83°C | | Boiling point | 262.7±35.0 °C(Predicted) | | density | 1.331±0.06 g/cm3(Predicted) | | vapor pressure | 0.061-2.2Pa at 20-50℃ | | storage temp. | 2-8°C | | form | powder to crystal | | pka | 8.89±0.15(Predicted) | | color | White to Orange to Green | | InChI | InChI=1S/C7H8ClNO/c1-4-2-3-5(9)6(8)7(4)10/h2-3,10H,9H2,1H3 | | InChIKey | XYRDGCCCBJITBH-UHFFFAOYSA-N | | SMILES | C1(O)=C(C)C=CC(N)=C1Cl | | LogP | 1.644 at 23℃ and pH7.27 | | Surface tension | 63.1mN/m at 1g/L and 21℃ | | CAS DataBase Reference | 84540-50-1(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36 | | Hazard Note | Irritant | | HS Code | 2922290090 |
| | 3-Amino-2-chlor-6-methylphenol Usage And Synthesis |
| Chemical Properties | Off white to light brown crystal powder |
| | 3-Amino-2-chlor-6-methylphenol Preparation Products And Raw materials |
|