|
ZINC 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-HEXADECAFLUORO-29H,31H-PHTHALOCYANINE Suppliers list
|
| Company Name: |
April Scientific Inc. |
| Tel: |
+886919825322 |
| Email: |
sales@aprilsci.com |
| Products Intro: |
Product Name:Zinc(II) 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadeca(fluoro)phthalocyanine
CAS:31396-84-6
Purity:95% Package:95% Remarks:Brand: April Scientific | Product Number: AP-PC-016 | Purity: 99%, Sublimation purification; 95%
|
|
|
|
|
| Company Name: |
Shanghai Acmec Biochemical Technology Co., Ltd. |
| Tel: |
+86-18621343501; +undefined18621343501 |
| Email: |
product@acmec-e.com |
| Products Intro: |
Product Name:Zinc 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecafluoro-29H,31H-phthalocyanine Dye content 90 %
CAS:31396-84-6
Purity:- Package:1g
|
|
|
|
|
| Company Name: |
Aladdin Scientific |
| Tel: |
|
| Email: |
tp@aladdinsci.com |
| Products Intro: |
Product Name:Zinc 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecafluoro-29H,31H-phthalocyanine
CAS:31396-84-6
Purity:Dye content 90% Package:$119.9/250mg;$319.9/1g;Bulk package Remarks:Dye content 90%
|
|
|
|
|
| Company Name: |
SHANGHAI KEAN TECHNOLOGY CO., LTD. |
| Tel: |
+8613817748580 |
| Email: |
cooperation@kean-chem.com |
| Products Intro: |
Product Name:Zinc 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecafluoro-29H,31H-phthalocyanine Dye content 90 %
CAS:31396-84-6
Purity:0.99 Package:100g;1kg;5KG;1KG
|
|
|
|
|
|
| | ZINC 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-HEXADECAFLUORO-29H,31H-PHTHALOCYANINE Basic information |
| Product Name: | ZINC 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-HEXADECAFLUORO-29H,31H-PHTHALOCYANINE | | Synonyms: | zinc 1,2,3,4,8,9,10,11,15,16,17,18,22,23;ZINC 1,2,3,4,8,9,10,11,15,16,17,18,22,23 , 24,25-HEXADECAFLUORO-PHTHALOCYANINE;ZINC 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-HEXADECAFLUORO-29H,31H-PHTHALOCYANINE;Zinc 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecafluoro-29H,31H-phthalocyanine Dye content 90 %;Zinc,[1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecafluoro-29H,31H-phthalocyaninato(2-)-kN29,kN30,kN31,kN32]-, (SP-4-1)-;Zinc,[1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-hexadecafluoro-29H,31H-phthalocyanin;zinc hexadecafluorophthalocyanine;Zinc perfluorophthalocyanine | | CAS: | 31396-84-6 | | MF: | C32F16N8Zn | | MW: | 865.76 | | EINECS: | | | Product Categories: | Infrared (IR) DyesPhotonic and Optical Materials;Organic Electronics and Photonics;Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Phthalocyanines | | Mol File: | 31396-84-6.mol |  |
| | ZINC 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-HEXADECAFLUORO-29H,31H-PHTHALOCYANINE Chemical Properties |
| Melting point | >300 °C(lit.) | | density | 1.8 g/cm3 | | form | powder | | λmax | 686 nm | | InChIKey | BEAYCAVYGQXGEJ-UHFFFAOYSA-N | | SMILES | C12=NC3=NC(=NC4=C5C(C(F)=C(F)C(F)=C5F)=C5N=C6C7C(F)=C(F)C(F)=C(F)C=7C(=N6)N=C(C6C(F)=C(F)C(F)=C(F)C1=6)N2[Zn]N45)C1C(F)=C(F)C(F)=C(F)C3=1 |c:4,t:0,19,35| |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 |
| | ZINC 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-HEXADECAFLUORO-29H,31H-PHTHALOCYANINE Usage And Synthesis |
| Uses | Used in a study of photodynamic tumor therapy. |
| | ZINC 1,2,3,4,8,9,10,11,15,16,17,18,22,23,24,25-HEXADECAFLUORO-29H,31H-PHTHALOCYANINE Preparation Products And Raw materials |
|