- BISMUTH NEODECANOATE
-
- $10.00 / 1KG
-
2026-01-30
- CAS:34364-26-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- BISMUTH NEODECANOATE
-
- $10.00/ kg
-
2025-02-13
- CAS:34364-26-6
- Min. Order: 1kg
- Purity: 99.99%
- Supply Ability: 10 tons
|
| | BISMUTH NEODECANOATE Basic information |
| | BISMUTH NEODECANOATE Chemical Properties |
| Boiling point | 300 °C(lit.) | | density | 1.145 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.479(lit.) | | Fp | >230 °F | | form | liquid | | Water Solubility | 2.76μg/L at 20.1℃ | | Stability: | Stable. Incompatible with strong oxidizing agents. Decomposes exothermically at temperatures around 300 C. | | InChI | InChI=1S/3C10H20O2.Bi/c3*1-4-5-6-7-8-10(2,3)9(11)12;/h3*4-8H2,1-3H3,(H,11,12);/q;;;+3/p-3 | | InChIKey | TUQRJVHQQXIPMN-UHFFFAOYSA-K | | SMILES | [Bi](OC(=O)C(C)(C)CCCCCC)(OC(=O)C(C)(C)CCCCCC)OC(=O)C(C)(C)CCCCCC | | EPA Substance Registry System | Bismuth(III) neodecanoate (34364-26-6) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | BISMUTH NEODECANOATE Usage And Synthesis |
| Chemical Properties | viscous light yellow liquid | | Uses | PU catalysts | | Flammability and Explosibility | Not classified | | reaction suitability | core: bismuth reagent type: catalyst |
| | BISMUTH NEODECANOATE Preparation Products And Raw materials |
|