4-(2-BROMOETHYL)PHENOL manufacturers
- 4-(2-BROMOETHYL)PHENOL
-
- $9.80 / 1.79999995231628KG
-
2020-01-09
- CAS:14140-15-9
- Min. Order: 1g
- Purity: ≥99%
- Supply Ability: 100kg
|
| | 4-(2-BROMOETHYL)PHENOL Basic information |
| Product Name: | 4-(2-BROMOETHYL)PHENOL | | Synonyms: | 2-(4-HYDROXYPHENYL)-1-BROMOETHANE;AKOS 228-26;4-HYDROXYPHENETHYL BROMIDE;4-HYDROXY-1-(2-BROMOETHYL)BENZENE;4-(2-BROMOETHYL)PHENOL;2-(4-Hydroxyphenyl)-1-bromoethane, 4-(2-Bromoethyl)phenol, 4-Hydroxy-1-(2-bromoethyl)benzene;4-Hydroxyphenethyl bromide 96%;4-(2-Bromoethyl)phenol 98% | | CAS: | 14140-15-9 | | MF: | C8H9BrO | | MW: | 201.06 | | EINECS: | 237-989-5 | | Product Categories: | Phenol&Thiophenol&Mercaptan | | Mol File: | 14140-15-9.mol |  |
| | 4-(2-BROMOETHYL)PHENOL Chemical Properties |
| Melting point | 88-92 °C(lit.) | | Boiling point | 276.5±15.0℃ (760 Torr) | | density | 1.501±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 121.1±20.4℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 9.91±0.15(Predicted) | | form | solid | | color | White to off-white | | InChI | InChI=1S/C8H9BrO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5-6H2 | | InChIKey | DYYVTFCYVZEQDG-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(CCBr)C=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 2908190090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(2-BROMOETHYL)PHENOL Usage And Synthesis |
| | 4-(2-BROMOETHYL)PHENOL Preparation Products And Raw materials |
|