- Metazachlor
-
- $970.00 / 5mg
-
2026-04-20
- CAS:67129-08-2
- Min. Order:
- Purity:
- Supply Ability: 10g
- Metazachlor
-
- $1.00 / 1kg
-
2019-07-06
- CAS:67129-08-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: Customized
|
| | Metazachlor Basic information |
| | Metazachlor Chemical Properties |
| Melting point | 74-78°C | | Boiling point | 439.2±45.0 °C(Predicted) | | density | 1.237-1.323 g/cm3(Temp: 25 °C) | | Fp | 2 °C | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform, Methanol | | pka | 1.54±0.10(Predicted) | | form | Solid | | color | Off-White to Pale Beige | | BRN | 621550 | | Henry's Law Constant | 1.3×101 mol/(m3Pa) at 25℃, Barcelo and Hennion (1997) | | Major Application | agriculture
environmental | | InChI | 1S/C14H16ClN3O/c1-11-5-3-6-12(2)14(11)18(13(19)9-15)10-17-8-4-7-16-17/h3-8H,9-10H2,1-2H3 | | InChIKey | STEPQTYSZVCJPV-UHFFFAOYSA-N | | SMILES | Cc1cccc(C)c1N(Cn2cccn2)C(=O)CCl | | LogP | 2.130 | | CAS DataBase Reference | 67129-08-2(CAS DataBase Reference) | | NIST Chemistry Reference | Acetamide, 2-chloro-n-(2,6-dimethylphenyl)-n-(1h-pyrazol-1-ylmethyl)-(67129-08-2) |
| Hazard Codes | Xn,F | | Risk Statements | 22-36-20/21/22-11-43 | | Safety Statements | 36-26-16-36/37 | | RIDADR | UN 1648 3/PG 2 | | WGK Germany | 3 | | RTECS | AB5442000 | | HS Code | 29331990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
Skin Sens. 1 |
| | Metazachlor Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | A chloroacetanilide herbicide used on vegetable crops. | | Definition | ChEBI: An organochlorine compound that is 2-chloroacetamide substituted by a 2,6-dimethylphenyl and a (1H-pyrazol-1-ylmethyl) group at the nitrogen atom. | | Metabolic pathway | Metazachlor is transformed in soil into 2-hydroxy-N-
(2,6-dimethylphenyl)-N-(1H-pyrazol-1-
ylmethyl)acetamide, 2-chloro-N-(2,6-
dimethylphenyl)acetamide, and 4,4' -methylenebis-(2,6-
dimethylbenzenamine), and the soil concentration of
the benzenamine is lower than 0.1 ppm. |
| | Metazachlor Preparation Products And Raw materials |
|