| Company Name: |
Shanghai eliv pharmaceutical Co.,Ltd.
|
| Tel: |
021-50158063 |
| Email: |
sales@elivpharma.com |
| Products Intro: |
Product Name:1,4-Dithiane-2,5-Di(Methanol)
CAS:460354-61-4
Purity:99% Package:1kg，25kg
|
|
| | 1,4-Dithiane-2,5-Di(Methanol) Basic information |
| | 1,4-Dithiane-2,5-Di(Methanol) Chemical Properties |
| Boiling point | 363.4±17.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | pka | 13.96±0.10(Predicted) | | InChI | InChI=1S/C6H12O2S2/c7-1-5-3-10-6(2-8)4-9-5/h5-8H,1-4H2 | | InChIKey | KRGJBPIZEJVDCR-UHFFFAOYSA-N | | SMILES | S1CC(CO)SCC1CO |
| | 1,4-Dithiane-2,5-Di(Methanol) Usage And Synthesis |
| Uses | 1,4-Dithiane-2,5-Di(Methanol) is a high-purity intermediate compound used in the synthesis of a wide range of important organics for the preparation of optical resin compositions with high heat resistance for use in optical compositions for blocking near-infrared light and lasers. |
| | 1,4-Dithiane-2,5-Di(Methanol) Preparation Products And Raw materials |
|