|
|
| | N-METHOXY-N-METHYLBENZAMIDE Basic information |
| | N-METHOXY-N-METHYLBENZAMIDE Chemical Properties |
| Boiling point | 70 °C0.1 mm Hg(lit.) | | density | 1.085 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.533(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colorless to yellow | | InChI | InChI=1S/C9H11NO2/c1-10(12-2)9(11)8-6-4-3-5-7-8/h3-7H,1-2H3 | | InChIKey | UKERDACREYXSIV-UHFFFAOYSA-N | | SMILES | C(N(OC)C)(=O)C1=CC=CC=C1 |
| WGK Germany | 3 | | HS Code | 2928009090 |
| | N-METHOXY-N-METHYLBENZAMIDE Usage And Synthesis |
| Uses | N-Methoxy-N-methylbenzamide is used to prepare orally bioavailable tetrasubstituted imidazoles as inhibitors of p38 mitogen-activated protein kinase. It is used to synthesize benzofuran and benzothiophene biphenyls as inhibitors of protein tyrosine phosphatase 1B with antihyperglycemic properties. | | Uses | N-Methoxy-N-methylbenzamide may be used in the preparation of β-trifluoromethyl enaminones. | | Definition | ChEBI: The Weinreb amide of benzoic acid. | | General Description | N-Methoxy-N-methylbenzamide is an N,N-disubstituted benzamide. also referred as Weinreb amide., Hydrogen bonding interactions between thioacetamide and N-methoxy-N-methylbenzamide has been investigated using near-infrared absorption spectroscopy. Preparation of N-methoxy-N-methylbenzamide has been reported. |
| | N-METHOXY-N-METHYLBENZAMIDE Preparation Products And Raw materials |
|