N,N-DIBENZYL-FORMAMIDE manufacturers
|
| | N,N-DIBENZYL-FORMAMIDE Basic information |
| | N,N-DIBENZYL-FORMAMIDE Chemical Properties |
| Melting point | 51-53°C | | Boiling point | 217 °C(Press: 12 Torr) | | density | 1.104±0.06 g/cm3(Predicted) | | refractive index | 1.5782 (589.3 nm 25℃) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform | | form | Solid | | pka | -0.50±0.70(Predicted) | | color | White | | InChI | InChI=1S/C15H15NO/c17-13-16(11-14-7-3-1-4-8-14)12-15-9-5-2-6-10-15/h1-10,13H,11-12H2 | | InChIKey | OTHBCWKTCXJYAW-UHFFFAOYSA-N | | SMILES | C(N(CC1=CC=CC=C1)CC1=CC=CC=C1)=O |
| | N,N-DIBENZYL-FORMAMIDE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | N,N-Dibenzylformamide (cas# 5464-77-7) is a compound useful in organic synthesis. |
| | N,N-DIBENZYL-FORMAMIDE Preparation Products And Raw materials |
|