N-(4-BROMOPHENYL)PHTHALIMIDE manufacturers
|
| | N-(4-BROMOPHENYL)PHTHALIMIDE Basic information |
| | N-(4-BROMOPHENYL)PHTHALIMIDE Chemical Properties |
| Melting point | 206 °C | | Boiling point | 449.5±47.0 °C(Predicted) | | density | 1.5999 (rough estimate) | | refractive index | 1.6320 (estimate) | | storage temp. | Store at room temperature | | pka | -1.41±0.20(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C14H8BrNO2/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(16)18/h1-8H | | InChIKey | DNQCPYWSXMATIN-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1C1=CC=C(Br)C=C1 |
| RTECS | TI4025000 | | HS Code | 2925.19.4200 |
| | N-(4-BROMOPHENYL)PHTHALIMIDE Usage And Synthesis |
| | N-(4-BROMOPHENYL)PHTHALIMIDE Preparation Products And Raw materials |
|