|
|
| | Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate Basic information | | Uses |
| Product Name: | Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate | | Synonyms: | Amisulpride Impurity 2;2-methoxy-4-amino-5-ethysulfonyl benzoic acid methyl ester;Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate;METHYL 4-AMINO-5-(ETHYLSULPHONYL)-2-METHOXYBENZOATE;2-methoxyl-4-amine-5-ethylsulfonyl methyl benzoate;2-Methoxyl-4-Amino-5-Ethylsulfonyl Methyl Benzoate;2-Methoxy-4-amino-5-ethsulfonyl benzoic acid methyl ester;2-METHOXYL-4-AMINO-5-ETHYLSULFONYLBENZOIC METHYL ESTER | | CAS: | 80036-89-1 | | MF: | C11H15NO5S | | MW: | 273.31 | | EINECS: | 616-818-1 | | Product Categories: | | | Mol File: | 80036-89-1.mol |  |
| | Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate Chemical Properties |
| Boiling point | 514.5±50.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | -2.97±0.13(Predicted) | | form | solid | | color | White | | InChI | InChI=1S/C11H15NO5S/c1-4-18(14,15)10-5-7(11(13)17-3)9(16-2)6-8(10)12/h5-6H,4,12H2,1-3H3 | | InChIKey | BBWJVKZAKHIKRQ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(S(CC)(=O)=O)=C(N)C=C1OC | | CAS DataBase Reference | 80036-89-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2922500090 |
| | Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate Usage And Synthesis |
| Uses | Methyl 4-amino-5-(ethylsulphonyl)-2-methoxybenzoate is a useful research chemical. |
| | Methyl 4-amino-5-ethylsulfonyl-2-methoxybenzoate Preparation Products And Raw materials |
|