|
| Z-TRANS-4-HYDROXY-L-PROLINOL Basic information |
| Z-TRANS-4-HYDROXY-L-PROLINOL Chemical Properties |
Boiling point | 240 °C(lit.) | density | 1.297 g/mL at 25 °C(lit.) | refractive index | n20/D 1.547(lit.) | Fp | >230 °F | storage temp. | 2-8°C | pka | 14.56±0.40(Predicted) | form | clear liquid | color | Colorless to Light orange to Yellow | optical activity | [α]20/D 33°, c = 15 in chloroform | InChI | InChI=1S/C13H17NO4/c15-8-11-6-12(16)7-14(11)13(17)18-9-10-4-2-1-3-5-10/h1-5,11-12,15-16H,6-9H2/t11-,12+/m0/s1 | InChIKey | WDEQGLDWZMIMJM-NWDGAFQWSA-N | SMILES | N1(C(OCC2=CC=CC=C2)=O)C[C@H](O)C[C@H]1CO |
Hazard Codes | Xi | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 2933998090 |
| Z-TRANS-4-HYDROXY-L-PROLINOL Usage And Synthesis |
| Z-TRANS-4-HYDROXY-L-PROLINOL Preparation Products And Raw materials |
|