- 5-BROMOGRAMINE
-
- $6.68 / 1KG
-
2020-01-13
- CAS: 830-93-3
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | 5-BROMOGRAMINE Basic information |
| | 5-BROMOGRAMINE Chemical Properties |
| Melting point | 149.5-150 °C | | Boiling point | 346.9±27.0 °C(Predicted) | | density | 1.449±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | form | Powder or Crystalline Powder | | pka | 16.04±0.30(Predicted) | | color | White to off-white | | InChI | InChI=1S/C11H13BrN2/c1-14(2)7-8-6-13-11-4-3-9(12)5-10(8)11/h3-6,13H,7H2,1-2H3 | | InChIKey | FSERHDPEOFYMMK-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(Br)C=C2)C(CN(C)C)=C1 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | RTECS | NL5170000 |
| | 5-BROMOGRAMINE Usage And Synthesis |
| Uses | 5-Bromogramine is an indole skeleton substituted with Br and CH3 at certain positions. 5-Bromogramine shows antifouling activity, with IC99 of 0.25 ppm[1]. | | References | [1] Kawamata M, et al. 5,6-Dichloro-1-methylgramine, a non-toxic antifoulant derived from a marine natural product. Prog Mol Subcell Biol. 2006;42:125-39. DOI:10.1007/3-540-30016-3_5 |
| | 5-BROMOGRAMINE Preparation Products And Raw materials |
|