|
|
| | 3,4,6-Tri-O-acetyl-D-galactal Basic information |
| Product Name: | 3,4,6-Tri-O-acetyl-D-galactal | | Synonyms: | (-)-TRI-O-ACETYL-D-GALACTAL;TRI-O-ACETYL-D-GALACTAL;D-GALACTAL TRIACETATE;3,4,6-TRI-O-ACETYL-D-GALACTAL;D- threeGalNAcene;(2R,3R,4R,5R,6R)-2-(acetoxymethyl)-5-azido-6-bromotetrahydro-2H-pyran-3,4-diyl diacetate;3,4,6-TRI-O-ACETYL-1,5-ANHYDRO-2-DEOXY-D-LYXO-HEX-1-ENITOL;3,4,6-TRI-O-ACETYL-1,5-ANHYDRO-D-LYXO-HEX-1-ENITOL | | CAS: | 4098-06-0 | | MF: | C12H16O7 | | MW: | 272.25 | | EINECS: | 223-859-5 | | Product Categories: | Carbohydrates & Derivatives;13C & 2H Sugars;Biochemistry;Galactose;Glycals;O-Substituted Sugars;Sugars;Sugars, Carbohydrates & Glucosides;Glycon Biochem | | Mol File: | 4098-06-0.mol |  |
| | 3,4,6-Tri-O-acetyl-D-galactal Chemical Properties |
| Melting point | 34-38 °C(lit.) | | Boiling point | 138-140 °C | | alpha | -20 º (c=1 CHCl3) | | density | 1.23 | | refractive index | 1.4645-1.4665 | | Fp | >230 °F | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in chloroform at 10mg/ml | | form | Oil or Solid | | color | Pale Yellow | | Water Solubility | Insoluble | | InChI | InChI=1/C12H16O7/c1-7(13)17-6-11-12(19-9(3)15)10(4-5-16-11)18-8(2)14/h4-5,10-12H,6H2,1-3H3/t10-,11-,12-/s3 | | InChIKey | LLPWGHLVUPBSLP-KJQXGZNINA-N | | SMILES | [C@H]1(OC(=O)C)[C@@H](COC(=O)C)OC=C[C@H]1OC(=O)C |&1:0,5,14,r| | | CAS DataBase Reference | 4098-06-0(CAS DataBase Reference) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | HS Code | 2940000080 |
| | 3,4,6-Tri-O-acetyl-D-galactal Usage And Synthesis |
| Chemical Properties | Pale Yellow Oil | | Uses | 3,4,6-Tri-O-acetyl-D-galactal is important building block for both solution- and solid-phase synthesis of oligosaccharides. |
| | 3,4,6-Tri-O-acetyl-D-galactal Preparation Products And Raw materials |
| Raw materials | D-Galactitol, 1,5-anhydro-, 2,3,4,6-tetraacetate-->C00984-->D-Galactopyranose pentaacetate-->2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide-->2,3,4,6-TETRA-O-ACETYL-ALPHA-D-GALACTOPYRANOSYL CHLORIDE-->D-(+)-GALACTOSE-->Acetic anhydride | | Preparation Products | D-Galactal-->6-O-(TRIISOPROPYLSILYL)-D-GALACTAL-->beta-D-Galactose pentaacetate-->TRI-O-BENZOYL-D-GALACTAL |
|