2-CHLOROBUTYRYL CHLORIDE manufacturers
|
| 2-CHLOROBUTYRYL CHLORIDE Basic information |
Product Name: | 2-CHLOROBUTYRYL CHLORIDE | Synonyms: | 2-Chlorobutyryl chloride, tech. 85%;2-CHLOROBUTYRYL CHLORIDE;Butanoyl chloride, 2-chloro-;2-CHLOROBUTYRYL CHLORIDE ISO 9001:2015 REACH;2 - chlorobutanoyl chloride | CAS: | 7623-11-2 | MF: | C4H6Cl2O | MW: | 141 | EINECS: | 000-000-0 | Product Categories: | | Mol File: | 7623-11-2.mol |  |
| 2-CHLOROBUTYRYL CHLORIDE Chemical Properties |
Boiling point | 138-140°C | density | 1,236 g/cm3 | refractive index | 1.4510 | Fp | 138-140°C | Water Solubility | Reacts with water. | Sensitive | Moisture Sensitive | BRN | 741947 | InChI | InChI=1S/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 | InChIKey | KVQJVAOMYWTLEO-UHFFFAOYSA-N | SMILES | C(Cl)(=O)C(Cl)CC |
Risk Statements | 34 | Safety Statements | 26-36/37/39 | RIDADR | 3265 | HazardClass | 8 | PackingGroup | II |
Provider | Language |
ALFA
| English |
| 2-CHLOROBUTYRYL CHLORIDE Usage And Synthesis |
Uses | 2-Chlorobutyryl chloride is used as a pharmaceutical intermediate. |
| 2-CHLOROBUTYRYL CHLORIDE Preparation Products And Raw materials |
|