|
|
| | N-SUCCINIMIDYL PALMITATE Basic information |
| | N-SUCCINIMIDYL PALMITATE Chemical Properties |
| Melting point | 81°C | | Boiling point | 447.1±28.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | BRN | 1547411 | | Stability: | Moisture Sensitive; Store in Freezer | | InChI | InChI=1S/C20H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(24)25-21-18(22)16-17-19(21)23/h2-17H2,1H3 | | InChIKey | OTNHQVHEZCBZQU-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCCCCCCCCCCCCCC |
| WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | N-SUCCINIMIDYL PALMITATE Usage And Synthesis |
| Description | N-Succinimidyl palmitate is an intermidate for synthesis of lipid molecules. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | | Chemical Properties | N-SUCCINIMIDYL PALMITATE is Colourless Shiny Flakes | | Uses | N-hydroxysuccinimide ester of palmitic acid. Esters of N-hydroxysuccinimide have been used for the preparation of N-acylamino acids, aminoacyl-tRNA, coenzyme A, thioglycolic acid, ceramides, etc. |
| | N-SUCCINIMIDYL PALMITATE Preparation Products And Raw materials |
|