[2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide manufacturers
|
| | [2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide Basic information |
| Product Name: | [2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide | | Synonyms: | dimethyl[2-[(2-methyl-1-oxoallyl)oxy]ethyl](3-sulphopropyl)ammonium hydroxide;DapsN,N-Dimethyl-N-(2-Methacryloyloxyethyl)-N-(3-Sulfopropyl)AmmoniumBetaine;N,N-Dimethyl-N-(2-methacryloyloxyethyl)-N-(3-sulfopropyl)-ammoniumbetaine;3-[Dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate;2-(Methacryloyloxy)ethyldimethyl(3-sulfonatopropyl)aminium;Dimethyl(3-sulfonatopropyl)[2-(methacryloyloxy)ethyl]aminium;Dimethyl[2-(methacryloyloxy)ethyl](3-sulfonatopropyl)aminium;N,N-Dimethyl-N-[2-(methacryloyloxy)ethyl]-3-sulfonatopropane-1-aminium | | CAS: | 3637-26-1 | | MF: | C11H21NO5S | | MW: | 279.35 | | EINECS: | 222-860-8 | | Product Categories: | | | Mol File: | 3637-26-1.mol | ![[2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide Structure](CAS/GIF/3637-26-1.gif) |
| | [2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide Chemical Properties |
| Melting point | 150-155 °C(lit.) | | density | 1.293-1.303g/cm3 at 22℃ | | Fp | >110°C | | storage temp. | Store below +30°C. | | solubility | 500g/l | | form | Powder | | color | White to Almost white | | PH | 6.3 (100g/l, H2O, 20℃) | | InChI | InChI=1S/C11H21NO5S/c1-10(2)11(13)17-8-7-12(3,4)6-5-9-18(14,15)16/h1,5-9H2,2-4H3 | | InChIKey | BCAIDFOKQCVACE-UHFFFAOYSA-N | | SMILES | [N+](C)(C)(CCOC(=O)C(=C)C)CCCS([O-])(=O)=O | | LogP | -4.23 |
| Hazard Codes | Xn | | Risk Statements | 21/22 | | Safety Statements | 37/39 | | WGK Germany | 3 | | HS Code | 29239000 |
| | [2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide Usage And Synthesis |
| Uses | Due to its hygroscopic nature, [2-(methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide (DMAPS) can contain up to one molecule of water per monomer unit. This material should be stored in a cool, dry place and depending on the reaction conditions, water may need to be removed prior to polymerization. | | Application | 2-(methacryloyloxy) ethyl] dimethyl (3-sulfopropyl) ammonium hydroxide (SBMA) is a zwitterionic monomer. This compound can be used to synthesize poly(sulfobetain methacrylate) (p(SBMA)) hydrogels of micro dimensions by inverse suspension polymerization. P(SBMA)) hydrogels are highly resistant to nonspecific protein adsorption and cell adhesion in vitro and in vivo. P(SBMA)) hydrogels have various biological applications, such as inhibition of bacterial adhesion and low fouling properties[1].
| | General Description | [2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide (DMAPS) is a hygroscopic, zwitterionic monomer used in the synthesis of polysulfobetaines. Polysulfobetaines are electrically neutral polymers that contain both cationic and anionic groups within a single monomer unit and feature interesting properties such as antielectrolyte behavior in aqueous salt solutions, biocompatibility, and hemocompatibility. Based upon these properties, polysulfobetaines are useful in many biomedical applications such as drug delivery and drug formulation. | | References |
[1] Muhammad Ajmal . “Betaine microgel preparation from 2-(methacryloyloxy) ethyl] dimethyl (3-sulfopropyl) ammonium hydroxide and its use as a catalyst system.” Colloids and Surfaces A: Physicochemical and Engineering Aspects 486 (2015): Pages 29-37.
|
| | [2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide Preparation Products And Raw materials |
|