|
|
| | 2-Amino-4,6-dimethylpyridine Basic information |
| Product Name: | 2-Amino-4,6-dimethylpyridine | | Synonyms: | Pyridine, 2-amino-4,6-dimethyl-;2-amino-4,6-dimethylpyridine (6-amino-2,4,-lutidine);2,4-Dimethyl-6-aminopyridine;6-Amino-2,4dimethylpyridine;4,6-dimethyl-2-pyridylamine;6-AMINO-2,4-LUTIDINE 98+%;6-Amino-2,4-lutidine, 4,6-Dimethylpyridin-2-amine;2-AMino-4,6-diMehtylpyridine | | CAS: | 5407-87-4 | | MF: | C7H10N2 | | MW: | 122.17 | | EINECS: | 226-470-9 | | Product Categories: | Heterocycle-Pyridine series;Amines;Pyridine series;Pyridines;Pyridine | | Mol File: | 5407-87-4.mol |  |
| | 2-Amino-4,6-dimethylpyridine Chemical Properties |
| Melting point | 63-64 °C (lit.) | | Boiling point | 235 °C (lit.) | | density | 1.0959 (rough estimate) | | refractive index | 1.6100 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Crystalline Powder | | pka | 7.62±0.35(Predicted) | | color | White to light brown | | InChI | InChI=1S/C7H10N2/c1-5-3-6(2)9-7(8)4-5/h3-4H,1-2H3,(H2,8,9) | | InChIKey | BRBUBVKGJRPRRD-UHFFFAOYSA-N | | SMILES | C1(N)=NC(C)=CC(C)=C1 | | CAS DataBase Reference | 5407-87-4(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Pyridinamine, 4,6-dimethyl-(5407-87-4) | | EPA Substance Registry System | 2-Pyridinamine, 4,6-dimethyl- (5407-87-4) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | US1818000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Amino-4,6-dimethylpyridine Usage And Synthesis |
| Chemical Properties | White to off-white crystalline | | Uses | 2-Amino-4,6-dimethylpyridine, can be used in the synthesis of various chemical compounds having therapeutic activity, such as in preparation of quinoline and quinoxaline compounds having anticancer activity. | | Uses | Organic intermediate. | | Application | 2-Amino-4,6-dimethylpyridine is a nonsteroidal anti-inflammatory drug that inhibits the production of prostaglandins and leukotrienes. 2-Amino-4,6-dimethylpyridine binds to the cyclooxygenase enzyme and blocks its conversion of arachidonic acid to prostaglandin H2. This compound has been shown to have potent inhibitory effects against Leishmania, with high values in reactive compounds. The molecular modeling of this compound shows that it has an unpaired amino function and an amide. | | Purification Methods | Recrystallise this base from hexane, ether/pet ether or *benzene. Residual *benzene is removed over paraffin-wax chips in an evacuated desiccator. The dipicrate crystallises from EtOH and has m 205-207o(dec). [Beilstein 22 III/IV 4210.] |
| | 2-Amino-4,6-dimethylpyridine Preparation Products And Raw materials |
|