|
|
| | 2-Amino-2'-fluoro-5-bromobenzophenone Basic information |
| | 2-Amino-2'-fluoro-5-bromobenzophenone Chemical Properties |
| Melting point | 100-104 °C | | Boiling point | 450.9±45.0 °C(Predicted) | | density | 1.5259 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | -1.12±0.10(Predicted) | | form | Solid | | color | Yellow | | Water Solubility | insoluble | | InChI | InChI=1S/C13H9BrFNO/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7H,16H2 | | InChIKey | XCOKDXNGCQXFCV-UHFFFAOYSA-N | | SMILES | C(C1=CC(Br)=CC=C1N)(C1=CC=CC=C1F)=O | | CAS DataBase Reference | 1479-58-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Amino-5-bromo-2'-fluorobenzophenone(1479-58-9) |
| Safety Statements | 24/25 | | HS Code | 29223990 |
| Provider | Language |
|
ACROS
| English |
| | 2-Amino-2'-fluoro-5-bromobenzophenone Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | Intermeidate in the preparation of many GABA modulators |
| | 2-Amino-2'-fluoro-5-bromobenzophenone Preparation Products And Raw materials |
|