2-CHLORO-5-FLUORO-6-PICOLINE manufacturers
- 6-Chloro-3-fluoro-2-methylpyridine
-
- $200.00 / 1KG
-
2025-09-25
- CAS:884494-78-4
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | 2-CHLORO-5-FLUORO-6-PICOLINE Basic information |
| | 2-CHLORO-5-FLUORO-6-PICOLINE Chemical Properties |
| Melting point | 58-60°C | | Boiling point | 163.4±35.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | -1.24±0.10(Predicted) | | form | Solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H5ClFN/c1-4-5(8)2-3-6(7)9-4/h2-3H,1H3 | | InChIKey | ICSRNKKGNHKSJH-UHFFFAOYSA-N | | SMILES | C1(C)=NC(Cl)=CC=C1F | | CAS DataBase Reference | 884494-78-4(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 2-CHLORO-5-FLUORO-6-PICOLINE Usage And Synthesis |
| | 2-CHLORO-5-FLUORO-6-PICOLINE Preparation Products And Raw materials |
|