|
|
| | Olprinone Impurity 24 Basic information |
| Product Name: | Olprinone Impurity 24 | | Synonyms: | Olprinone Impurity 24;2-Propanone, 1-(7-methylimidazo[1,2-a]pyridin-6-yl)-;1-(7-methylimidazo[1,2-a]pyridin-6-yl)-2-propanone | | CAS: | 116355-12-5 | | MF: | C11H12N2O | | MW: | 188.23 | | EINECS: | | | Product Categories: | | | Mol File: | 116355-12-5.mol |  |
| | Olprinone Impurity 24 Chemical Properties |
| density | 1.15±0.1 g/cm3(Predicted) | | pka | 7.10±0.50(Predicted) | | InChI | InChI=1S/C11H12N2O/c1-8-5-11-12-3-4-13(11)7-10(8)6-9(2)14/h3-5,7H,6H2,1-2H3 | | InChIKey | RQQHLVJIQLMZOI-UHFFFAOYSA-N | | SMILES | C(C1=CN2C=CN=C2C=C1C)C(=O)C |
| | Olprinone Impurity 24 Usage And Synthesis |
| | Olprinone Impurity 24 Preparation Products And Raw materials |
|